EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C=C\[C@@H](O)C/C=C\C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H32O4/c1-2-3-10-15-20(23)17-12-8-9-13-18-21(24)16-11-6-4-5-7-14-19-22(25)26/h3,5-13,17-18,20-21,23-24H,2,4,14-16,19H2,1H3,(H,25,26)/b7-5-,9-8-,10-3-,11-6-,17-12+,18-13+/t20-,21-/m0/s1 |
| InChIKey | CRDZYJSQHCXHEG-XLBFCUQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (24262603) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4Z,7Z,10S,11E,13Z,15E,17S,19Z)-10,17-dihydroxydocosahexaenoic acid (CHEBI:138653) has role anti-inflammatory agent (CHEBI:67079) |
| (4Z,7Z,10S,11E,13Z,15E,17S,19Z)-10,17-dihydroxydocosahexaenoic acid (CHEBI:138653) has role human xenobiotic metabolite (CHEBI:76967) |
| (4Z,7Z,10S,11E,13Z,15E,17S,19Z)-10,17-dihydroxydocosahexaenoic acid (CHEBI:138653) is a dihydroxydocosahexaenoic acid (CHEBI:137348) |
| (4Z,7Z,10S,11E,13Z,15E,17S,19Z)-10,17-dihydroxydocosahexaenoic acid (CHEBI:138653) is a protectin (CHEBI:193572) |
| (4Z,7Z,10S,11E,13Z,15E,17S,19Z)-10,17-dihydroxydocosahexaenoic acid (CHEBI:138653) is a secondary allylic alcohol (CHEBI:134396) |
| Incoming Relation(s) |
| 10S,17S-DiHDoHE(1-) (CHEBI:747177) is conjugate base of (4Z,7Z,10S,11E,13Z,15E,17S,19Z)-10,17-dihydroxydocosahexaenoic acid (CHEBI:138653) |
| IUPAC Name |
|---|
| (4Z,7Z,10S,11E,13Z,15E,17S,19Z)-10,17-dihydroxydocosa-4,7,11,13,15,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 10(S),17(S)-dihydroxydocosa-4Z,7Z,11E,13Z,15E,19Z-hexaenoic acid | ChEBI |
| 10S,17S-diHDHA | LIPID MAPS |
| (10S,17S)-DiHDHA | ChEBI |
| 10(S),17(S)-DiHDHA | ChEBI |
| 10S,17S-DiHDoHE | LIPID MAPS |
| 10S,17S-dihydroxy-4Z,7Z,11E,13Z,15E,19Z-docosahexaenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA04040003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19424117 | Reaxys |
| Citations |
|---|