EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O2 |
| Net Charge | 0 |
| Average Mass | 336.435 |
| Monoisotopic Mass | 336.18378 |
| SMILES | CC(=O)c1ccc2c(c1)c1cc(C(C)=O)ccc1n2CCNC(C)C |
| InChI | InChI=1S/C21H24N2O2/c1-13(2)22-9-10-23-20-7-5-16(14(3)24)11-18(20)19-12-17(15(4)25)6-8-21(19)23/h5-8,11-13,22H,9-10H2,1-4H3 |
| InChIKey | JKCSODVERGVDLT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | p53 activator Any activator of tumour protein p53. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CBL0137 (CHEBI:138650) has role antineoplastic agent (CHEBI:35610) |
| CBL0137 (CHEBI:138650) has role apoptosis inducer (CHEBI:68495) |
| CBL0137 (CHEBI:138650) has role NF-κB inhibitor (CHEBI:73240) |
| CBL0137 (CHEBI:138650) has role p53 activator (CHEBI:77731) |
| CBL0137 (CHEBI:138650) is a aromatic ketone (CHEBI:76224) |
| CBL0137 (CHEBI:138650) is a carbazoles (CHEBI:48513) |
| CBL0137 (CHEBI:138650) is a methyl ketone (CHEBI:51867) |
| CBL0137 (CHEBI:138650) is a secondary amino compound (CHEBI:50995) |
| CBL0137 (CHEBI:138650) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 1,1'-{9-[2-(isopropylamino)ethyl]-9H-carbazole-3,6-diyl}diethanone |
| Synonyms | Source |
|---|---|
| 1,1'-{9-[2-(propan-2-ylamino)ethyl]-9H-carbazole-3,6-diyl}diethanone | IUPAC |
| 3,6-diacetyl-9-(2-isopropylethyl)-9H-carbazole | ChEBI |
| CBL-0137 free base | ChemIDplus |
| CBLC137 | SUBMITTER |
| Curaxin 137 | SUBMITTER |
| Curaxin-137 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO2013148864 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24576552 | Reaxys |
| CAS:1197996-80-7 | ChemIDplus |
| Citations |
|---|