EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O5 |
| Net Charge | 0 |
| Average Mass | 376.493 |
| Monoisotopic Mass | 376.22497 |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C/C=C\C=C\C=C\[C@@H](O)[C@@H](O)CCC(=O)O |
| InChI | InChI=1S/C22H32O5/c1-2-3-11-14-19(23)15-12-9-7-5-4-6-8-10-13-16-20(24)21(25)17-18-22(26)27/h3-4,6-13,15-16,19-21,23-25H,2,5,14,17-18H2,1H3,(H,26,27)/b6-4-,9-7-,10-8+,11-3-,15-12+,16-13+/t19-,20+,21-/m0/s1 |
| InChIKey | YKPLJNOOLKUEBS-RIYRYSNMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (26462421) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resolvin D4 (CHEBI:138649) has role anti-inflammatory agent (CHEBI:67079) |
| resolvin D4 (CHEBI:138649) has role human xenobiotic metabolite (CHEBI:76967) |
| resolvin D4 (CHEBI:138649) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| resolvin D4 (CHEBI:138649) is a resolvin (CHEBI:132120) |
| resolvin D4 (CHEBI:138649) is a secondary allylic alcohol (CHEBI:134396) |
| resolvin D4 (CHEBI:138649) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (4S,5R,6E,8E,10Z,13Z,15E,17S,19Z)-4,5,17-trihydroxydocosa-6,8,10,13,15,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| (4S,5R,6E,8E,10Z,13Z,15E,17S,19Z)-4,5,17-trihydroxydocosahexaenoic acid | ChEBI |
| RvD4 | SUBMITTER |
| Citations |
|---|