EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:138645 - resolvin D5
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C/C=C\C=C\[C@@H](O)C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H32O4/c1-2-3-10-15-20(23)16-11-7-5-4-6-8-12-17-21(24)18-13-9-14-19-22(25)26/h3,5-13,16-17,20-21,23-24H,2,4,14-15,18-19H2,1H3,(H,25,26)/b7-5-,8-6-,10-3-,13-9-,16-11+,17-12+/t20-,21+/m0/s1 |
| InChIKey | CFOFZYMMJZILHE-XGTWDWJNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (16303609) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (16303609) | |
| Oncorhynchus mykiss (ncbitaxon:8022) | - | PubMed (16303609) | |
| Trypanosoma cruzi (ncbitaxon:5693) | - | PubMed (29358332) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound in marine macro- and microorganisms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resolvin D5 (CHEBI:138645) has role animal metabolite (CHEBI:75767) |
| resolvin D5 (CHEBI:138645) has role anti-inflammatory agent (CHEBI:67079) |
| resolvin D5 (CHEBI:138645) has role human metabolite (CHEBI:77746) |
| resolvin D5 (CHEBI:138645) has role human xenobiotic metabolite (CHEBI:76967) |
| resolvin D5 (CHEBI:138645) has role marine xenobiotic metabolite (CHEBI:83399) |
| resolvin D5 (CHEBI:138645) has role mouse metabolite (CHEBI:75771) |
| resolvin D5 (CHEBI:138645) has role platelet aggregation inhibitor (CHEBI:50427) |
| resolvin D5 (CHEBI:138645) is a diol (CHEBI:23824) |
| resolvin D5 (CHEBI:138645) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| resolvin D5 (CHEBI:138645) is a resolvin (CHEBI:132120) |
| resolvin D5 (CHEBI:138645) is a secondary allylic alcohol (CHEBI:134396) |
| resolvin D5 (CHEBI:138645) is conjugate acid of resolvin D5(1−) (CHEBI:140352) |
| Incoming Relation(s) |
| resolvin D5(1−) (CHEBI:140352) is conjugate base of resolvin D5 (CHEBI:138645) |
| IUPAC Name |
|---|
| (4Z,7S,8E,10Z,13Z,15E,17S,19Z)-7,17-dihydroxydocosa-4,8,10,13,15,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| (4Z,7S,8E,10Z,13Z,15E,17S,19Z)-7,17-dihydroxydocosahexaenoic acid | ChEBI |
| 7S,17S-diHDHA | ChEBI |
| 7(S),17(S)-diHDHA | ChEBI |
| 7S,17S-dihydroxy-4Z,8E,10Z,13Z,15E,19Z-docosahexaenoic acid | ChEBI |
| 7(S),17(S)-resolvin D5 | ChEBI |
| resolvin-D5 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 45743318 | ChemSpider |
| FDB023286 | FooDB |
| HMDB0004038 | HMDB |
| LMFA04030003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:578008-43-2 | ChEBI |
| Citations |
|---|