EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:138643 - resolvin D6
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C/C=C\C/C=C\C=C\[C@@H](O)CCC(=O)O |
| InChI | InChI=1S/C22H32O4/c1-2-3-12-15-20(23)16-13-10-8-6-4-5-7-9-11-14-17-21(24)18-19-22(25)26/h3-5,8-14,16-17,20-21,23-24H,2,6-7,15,18-19H2,1H3,(H,25,26)/b5-4-,10-8-,11-9-,12-3-,16-13+,17-14+/t20-,21+/m0/s1 |
| InChIKey | JKPUWSZSJINVLB-OSKNXYPTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (27121596) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resolvin D6 (CHEBI:138643) has role anti-inflammatory agent (CHEBI:67079) |
| resolvin D6 (CHEBI:138643) has role human xenobiotic metabolite (CHEBI:76967) |
| resolvin D6 (CHEBI:138643) is a diol (CHEBI:23824) |
| resolvin D6 (CHEBI:138643) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| resolvin D6 (CHEBI:138643) is a resolvin (CHEBI:132120) |
| resolvin D6 (CHEBI:138643) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| (4S,5E,7Z,10Z,13Z,15E,17S,19Z)-4,17-dihydroxydocosa-5,7,10,13,15,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| RvD6 | SUBMITTER |
| 4S,17S-dihydroxy-5E,7Z,10Z,13Z,15E,19Z-docosahexaenoic acid | LIPID MAPS |
| (4S,5E,7Z,10Z,13Z,15E,17S,19Z)-4,17-dihydroxydocosahexaenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA04030004 | LIPID MAPS |
| US2010159540 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14535278 | Reaxys |
| Citations |
|---|