EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O5 |
| Net Charge | 0 |
| Average Mass | 376.493 |
| Monoisotopic Mass | 376.22497 |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C/C=C\C/C=C\C=C\[C@H](CCC(=O)O)OO |
| InChI | InChI=1S/C22H32O5/c1-2-3-12-15-20(23)16-13-10-8-6-4-5-7-9-11-14-17-21(27-26)18-19-22(24)25/h3-5,8-14,16-17,20-21,23,26H,2,6-7,15,18-19H2,1H3,(H,24,25)/b5-4-,10-8-,11-9-,12-3-,16-13+,17-14+/t20-,21+/m0/s1 |
| InChIKey | ZKUDWLWHTKEJGJ-OSKNXYPTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4(S)-hydroperoxy-17(S)-hydroxydocosahexaenoic acid (CHEBI:138641) is a hydroperoxy polyunsaturated fatty acid (CHEBI:189832) |
| 4(S)-hydroperoxy-17(S)-hydroxydocosahexaenoic acid (CHEBI:138641) is a hydroxydocosahexaenoic acid (CHEBI:72790) |
| IUPAC Name |
|---|
| (4S,5E,7Z,10Z,13Z,15E,17S,19Z)-4-hydroperoxy-17-hydroxydocosa-5,7,10,13,15,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 4(S)-Hp-17(S)-HDHA | SUBMITTER |
| 4S-hydroperoxy-17S-HDHA | LIPID MAPS |
| 4(S)-hydroperoxy-17(S)-HDHA | ChEBI |
| 4S-hydroperoxy-17S-hydroxy-5E,7Z,10Z,13Z,15E,19Z-docosahexaenoic acid | LIPID MAPS |
| 4S-hydroperoxy-17S-hydroxy-DHA | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA04000068 | LIPID MAPS |
| Citations |
|---|