EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O3 |
| Net Charge | 0 |
| Average Mass | 344.495 |
| Monoisotopic Mass | 344.23514 |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H32O3/c1-2-3-15-18-21(23)19-16-13-11-9-7-5-4-6-8-10-12-14-17-20-22(24)25/h3,5-8,11-16,19,21,23H,2,4,9-10,17-18,20H2,1H3,(H,24,25)/b7-5-,8-6-,13-11-,14-12-,15-3-,19-16+/t21-/m0/s1 |
| InChIKey | SWTYBBUBEPPYCX-YTQNUIGOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bovinae (ncbitaxon:27592) | - | PubMed (21156816) | |
| Homo sapiens (ncbitaxon:9606) | blood (UBERON:0000178) | PubMed (22912397) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17(S)-HDoHE (CHEBI:138640) has role animal metabolite (CHEBI:75767) |
| 17(S)-HDoHE (CHEBI:138640) has role human xenobiotic metabolite (CHEBI:76967) |
| 17(S)-HDoHE (CHEBI:138640) has role mouse metabolite (CHEBI:75771) |
| 17(S)-HDoHE (CHEBI:138640) is a (4Z,7Z,10Z,13Z,15E,19Z)-17-hydroxydocosahexaenoic acid (CHEBI:72637) |
| 17(S)-HDoHE (CHEBI:138640) is enantiomer of 17(R)-HDoHE (CHEBI:91137) |
| Incoming Relation(s) |
| 17(R)-HDoHE (CHEBI:91137) is enantiomer of 17(S)-HDoHE (CHEBI:138640) |
| IUPAC Name |
|---|
| (4Z,7Z,10Z,13Z,15E,17S,19Z)-17-hydroxydocosa-4,7,10,13,15,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 17S-HDHA | LIPID MAPS |
| 17S-hydroxy-4Z,7Z,10Z,13Z,15E,19Z-docosahexaenoic acid | LIPID MAPS |
| 17S-hydroxy DHA | ChEBI |
| (17S)-hydroxydocosahexaenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-17450 | MetaCyc |
| LMFA04000012 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:92693-03-3 | ChEBI |
| Citations |
|---|