EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28NO4 |
| Net Charge | -1 |
| Average Mass | 322.425 |
| Monoisotopic Mass | 322.20238 |
| SMILES | CC/C=C\CC1C(=O)CC[C@@H]1CC(=O)N[C@H](C(=O)[O-])[C@@H](C)CC |
| InChI | InChI=1S/C18H29NO4/c1-4-6-7-8-14-13(9-10-15(14)20)11-16(21)19-17(18(22)23)12(3)5-2/h6-7,12-14,17H,4-5,8-11H2,1-3H3,(H,19,21)(H,22,23)/p-1/b7-6-/t12-,13+,14?,17-/m0/s1 |
| InChIKey | IBZYPBGPOGJMBF-LVJZJYDISA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(3R)-jasmonyl]-L-isoleucinate (CHEBI:138627) is a N-jasmonyl-L-α-amino acid anion (CHEBI:136183) |
| N-[(3R)-jasmonyl]-L-isoleucinate (CHEBI:138627) is conjugate base of N-[(3R)-jasmonyl]-L-isoleucine (CHEBI:139302) |
| Incoming Relation(s) |
| N-[(+)-7-isojasmonyl]-L-isoleucinate (CHEBI:136180) is a N-[(3R)-jasmonyl]-L-isoleucinate (CHEBI:138627) |
| N-[(3R)-jasmonyl]-L-isoleucine (CHEBI:139302) is conjugate acid of N-[(3R)-jasmonyl]-L-isoleucinate (CHEBI:138627) |
| IUPAC Name |
|---|
| (2S,3S)-3-methyl-2-(2-{(1R)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}acetamido)pentanoate |
| Synonym | Source |
|---|---|
| (3R)-jasmonoyl-L-isoleucinate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| a jasmonyl-L-isoleucinate | UniProt |
| Citations |
|---|