EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5O2S2 |
| Net Charge | -1 |
| Average Mass | 149.216 |
| Monoisotopic Mass | 148.97364 |
| SMILES | O=C([O-])C1CSSC1 |
| InChI | InChI=1S/C4H6O2S2/c5-4(6)3-1-7-8-2-3/h3H,1-2H2,(H,5,6)/p-1 |
| InChIKey | AYGMEFRECNWRJC-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asparagusate (CHEBI:13862) has parent hydride 1,2-dithiolane (CHEBI:38226) |
| asparagusate (CHEBI:13862) is a dithiolanes (CHEBI:39192) |
| asparagusate (CHEBI:13862) is a monocarboxylic acid anion (CHEBI:35757) |
| asparagusate (CHEBI:13862) is conjugate base of asparagusic acid (CHEBI:18091) |
| Incoming Relation(s) |
| asparagusic acid (CHEBI:18091) is conjugate acid of asparagusate (CHEBI:13862) |
| IUPAC Name |
|---|
| 1,2-dithiolane-4-carboxylate |
| UniProt Name | Source |
|---|---|
| asparagusate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4800403 | Beilstein |