EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | CC/C=C\C[C@@H](O)/C=C/C=C\C/C=C\C=C\[C@@H](O)/C=C\CCCC(=O)O |
| InChI | InChI=1S/C22H32O4/c1-2-3-10-15-20(23)16-11-7-5-4-6-8-12-17-21(24)18-13-9-14-19-22(25)26/h3,5-8,10-13,16-18,20-21,23-24H,2,4,9,14-15,19H2,1H3,(H,25,26)/b7-5-,8-6-,10-3-,16-11+,17-12+,18-13-/t20-,21-/m1/s1 |
| InChIKey | JBRPFYYLEQERPG-RIVVZJRMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspirin-triggered resolvin D5 (CHEBI:138617) has role anti-inflammatory agent (CHEBI:67079) |
| aspirin-triggered resolvin D5 (CHEBI:138617) has role human xenobiotic metabolite (CHEBI:76967) |
| aspirin-triggered resolvin D5 (CHEBI:138617) is a diol (CHEBI:23824) |
| aspirin-triggered resolvin D5 (CHEBI:138617) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| aspirin-triggered resolvin D5 (CHEBI:138617) is a resolvin (CHEBI:132120) |
| aspirin-triggered resolvin D5 (CHEBI:138617) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| (5Z,7S,8E,10Z,13Z,15Z,17R,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 17-epi-resolvin D5 | ChEBI |
| 17-epi-RvD2 | ChEBI |
| (5Z,7S,8E,10Z,13Z,15Z,17R,19Z)-7,17-dihydroxydocosahexaenoic acid | ChEBI |
| aspirin-triggered RvD5 | ChEBI |
| AT-RvD5 | SUBMITTER |