EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O3 |
| Net Charge | -1 |
| Average Mass | 117.124 |
| Monoisotopic Mass | 117.05572 |
| SMILES | CC[C@H](O)CC(=O)[O-] |
| InChI | InChI=1S/C5H10O3/c1-2-4(6)3-5(7)8/h4,6H,2-3H2,1H3,(H,7,8)/p-1/t4-/m0/s1 |
| InChIKey | REKYPYSUBKSCAT-BYPYZUCNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-hydroxypentanoate (CHEBI:138608) is a 3-hydroxy fatty acid anion (CHEBI:84196) |
| (S)-3-hydroxypentanoate (CHEBI:138608) is a short-chain fatty acid anion (CHEBI:58951) |
| (S)-3-hydroxypentanoate (CHEBI:138608) is conjugate base of (S)-3-hydroxypentanoic acid (CHEBI:139270) |
| (S)-3-hydroxypentanoate (CHEBI:138608) is enantiomer of (R)-3-hydroxypentanoate (CHEBI:138588) |
| Incoming Relation(s) |
| (S)-3-hydroxypentanoic acid (CHEBI:139270) is conjugate acid of (S)-3-hydroxypentanoate (CHEBI:138608) |
| (R)-3-hydroxypentanoate (CHEBI:138588) is enantiomer of (S)-3-hydroxypentanoate (CHEBI:138608) |
| IUPAC Name |
|---|
| (3S)-3-hydroxypentanoate |
| Synonyms | Source |
|---|---|
| (3S)-hydroxyvalerate | SUBMITTER |
| (S)-3-hydroxyvalerate | ChEBI |
| UniProt Name | Source |
|---|---|
| (3S)-3-hydroxypentanoate | UniProt |
| Citations |
|---|