EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N6O4S2 |
| Net Charge | 0 |
| Average Mass | 400.486 |
| Monoisotopic Mass | 400.09875 |
| SMILES | Cn1cnc(SSc2ncn(C)c2C[C@H](N)C(=O)O)c1C[C@H](N)C(=O)O |
| InChI | InChI=1S/C14H20N6O4S2/c1-19-5-17-11(9(19)3-7(15)13(21)22)25-26-12-10(20(2)6-18-12)4-8(16)14(23)24/h5-8H,3-4,15-16H2,1-2H3,(H,21,22)(H,23,24)/t7-,8-/m0/s1 |
| InChIKey | NRGVZXSKWPQYMK-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ovothiol A disulfide (CHEBI:138530) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| ovothiol A disulfide (CHEBI:138530) is a organic disulfide (CHEBI:35489) |
| Manual Xrefs | Databases |
|---|---|
| 168775 | ChemSpider |