EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H50NO7P |
| Net Charge | 0 |
| Average Mass | 507.649 |
| Monoisotopic Mass | 507.33249 |
| SMILES | [H][C@@](CO)(COP(=O)(O)OCCN)OC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C25H50NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-25(28)33-24(22-27)23-32-34(29,30)31-21-20-26/h9-10,24,27H,2-8,11-23,26H2,1H3,(H,29,30)/b10-9-/t24-/m1/s1 |
| InChIKey | DGAUETYRWFLGRT-OPSAWKISSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(11Z-icosenoyl)-sn-glycero-3-phosphoethanolamine (CHEBI:138517) is a lysophosphatidylethanolamine 20:1 (CHEBI:132557) |
| Synonyms | Source |
|---|---|
| (2-aminoethoxy)[(2R)-3-hydroxy-2-[(11Z)-icos-11-enoyloxy]propoxy]phosphinic acid | LIPID MAPS |
| LysoPE(0:0/20:1(11Z)) | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011482 | HMDB |
| LMGP02050046 | LIPID MAPS |