EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28N4O4 |
| Net Charge | 0 |
| Average Mass | 436.512 |
| Monoisotopic Mass | 436.21106 |
| SMILES | CC(C)(C)OC(=O)Nc1ccc2c(c1)C(NC(=O)Nc1cccc(C#N)c1)CC(C)(C)O2 |
| InChI | InChI=1S/C24H28N4O4/c1-23(2,3)32-22(30)27-17-9-10-20-18(12-17)19(13-24(4,5)31-20)28-21(29)26-16-8-6-7-15(11-16)14-25/h6-12,19H,13H2,1-5H3,(H,27,30)(H2,26,28,29) |
| InChIKey | CJYMCBSCMOLHIE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BPDZ 711 (CHEBI:138512) has role antineoplastic agent (CHEBI:35610) |
| BPDZ 711 (CHEBI:138512) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| BPDZ 711 (CHEBI:138512) is a carbamate ester (CHEBI:23003) |
| BPDZ 711 (CHEBI:138512) is a chromanes (CHEBI:23230) |
| BPDZ 711 (CHEBI:138512) is a nitrile (CHEBI:18379) |
| BPDZ 711 (CHEBI:138512) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| tert-butyl (4-{[(3-cyanophenyl)carbamoyl]amino}-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-6-yl)carbamate |
| Synonyms | Source |
|---|---|
| N-3-cyanophenyl-N'-(6-tert-butoxycarbonylamino-3,4-dihydro-2,2-dimethyl-2H-1-benzopyran-4-yl)urea | SUBMITTER |
| tert-butyl N-[4-[(3-cyanophenyl)carbamoylamino]-2,2-dimethyl-3,4-dihydrochromen-6-yl]carbamate | ChEBI |
| BPDZ711 | ChEBI |
| BPDZ-711 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 60141294 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22763649 | Reaxys |
| Citations |
|---|