EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37NO4 |
| Net Charge | 0 |
| Average Mass | 415.574 |
| Monoisotopic Mass | 415.27226 |
| SMILES | C/C=C(\C)[C@H](O)[C@H](C)/C=C(C)/C=C/C/C(C)=C/Cc1nc(OC)c(OC)c(O)c1C |
| InChI | InChI=1S/C25H37NO4/c1-9-18(4)22(27)19(5)15-17(3)12-10-11-16(2)13-14-21-20(6)23(28)24(29-7)25(26-21)30-8/h9-10,12-13,15,19,22,27H,11,14H2,1-8H3,(H,26,28)/b12-10+,16-13+,17-15+,18-9+/t19-,22+/m1/s1 |
| InChIKey | BBLGCDSLCDDALX-LKGBESRRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces xanthocidicus (ncbitaxon:83382) | - | PubMed (26856451) | |
| Streptomyces piomogenes (ncbitaxon:285508) | - | PubMed (22365607) | |
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (17721005) | Strain: ML55 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 1.6.5.3 [NADH:ubiquinone reductase (H(+)-translocating)] inhibitor A respiratory-chain inhibitor that interferes with the action of the the enzyme NADH:ubiquinone reductase (H+-translocating), EC 1.6.5.3. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piericidin A (CHEBI:138511) has role antimicrobial agent (CHEBI:33281) |
| piericidin A (CHEBI:138511) has role bacterial metabolite (CHEBI:76969) |
| piericidin A (CHEBI:138511) has role EC 1.6.5.3 [NADH:ubiquinone reductase (H+-translocating)] inhibitor (CHEBI:38503) |
| piericidin A (CHEBI:138511) has role mitochondrial respiratory-chain inhibitor (CHEBI:25355) |
| piericidin A (CHEBI:138511) is a aromatic ether (CHEBI:35618) |
| piericidin A (CHEBI:138511) is a methylpyridines (CHEBI:25340) |
| piericidin A (CHEBI:138511) is a monohydroxypyridine (CHEBI:38182) |
| piericidin A (CHEBI:138511) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| 2-[(2E,5E,7E,9R,10R,11E)-10-hydroxy-3,7,9,11-tetramethyltrideca-2,5,7,11-tetraen-1-yl]-5,6-dimethoxy-3-methylpyridin-4-ol |
| Synonyms | Source |
|---|---|
| 2-[(2E,5E,7E,11E)-10R-hydroxy-3,7,9R,11-tetramethyl-2,5,7,11-tridecatetraen-1-yl]-5,6-dimethoxy-3-methyl-4-pyridinol | SUBMITTER |
| Shaoguanmycin B | ChemIDplus |
| 2-[(2E,5E,7E,9R,10R,11E)-10-hydroxy-3,7,9,11-tetramethyltrideca-2,5,7,11-tetraenyl]-5,6-dimethoxy-3-methyl-1H-pyridin-4-one | SUBMITTER |
| SN 198E | ChemIDplus |
| Piericidin A1 | ChemIDplus |
| (+)-piericidin A1 | ChEBI |
| Citations |
|---|