EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C21H12O7 |
| Net Charge | 0 |
| Average Mass | 752.640 |
| Monoisotopic Mass | 752.11661 |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21.O=C(O)c1ccc2c(c1)C1(OC2=O)c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/2C21H12O7/c22-11-2-5-15-17(8-11)27-18-9-12(23)3-6-16(18)21(15)14-4-1-10(19(24)25)7-13(14)20(26)28-21;22-11-2-5-14-17(8-11)27-18-9-12(23)3-6-15(18)21(14)16-7-10(19(24)25)1-4-13(16)20(26)28-21/h2*1-9,22-23H,(H,24,25) |
| InChIKey | BPVHBBXCESDRKW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | tracer A role played by a foreign substance mixed with or attached to a given substance to enable the distribution or location of the latter to be determined subsequently. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5(6)-carboxyfluorescein (CHEBI:138465) has part 5-carboxyfluorescein (CHEBI:51617) |
| 5(6)-carboxyfluorescein (CHEBI:138465) has part 6-carboxyfluorescein (CHEBI:39073) |
| 5(6)-carboxyfluorescein (CHEBI:138465) has role fluorescent dye (CHEBI:51121) |
| 5(6)-carboxyfluorescein (CHEBI:138465) has role tracer (CHEBI:35204) |
| 5(6)-carboxyfluorescein (CHEBI:138465) is a mixture (CHEBI:60004) |
| Synonyms | Source |
|---|---|
| 5(6)-FAM | ChEBI |
| 5-(and-6)-carboxyfluorescein | ChEBI |
| 5-(and-6)-FAM | ChEBI |