EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H40N4 |
| Net Charge | 0 |
| Average Mass | 492.711 |
| Monoisotopic Mass | 492.32530 |
| SMILES | c1ccc2c(NCCCCCCCNc3c4c(nc5ccccc35)CCCC4)c3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C33H40N4/c1(2-12-22-34-32-24-14-4-8-18-28(24)36-29-19-9-5-15-25(29)32)3-13-23-35-33-26-16-6-10-20-30(26)37-31-21-11-7-17-27(31)33/h4,6,8,10,14,16,18,20H,1-3,5,7,9,11-13,15,17,19,21-23H2,(H,34,36)(H,35,37) |
| InChIKey | ITZOKHKOFJOBFS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis(7)-tacrine (CHEBI:138435) has functional parent tacrine (CHEBI:45980) |
| bis(7)-tacrine (CHEBI:138435) has role apoptosis inhibitor (CHEBI:68494) |
| bis(7)-tacrine (CHEBI:138435) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| bis(7)-tacrine (CHEBI:138435) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| bis(7)-tacrine (CHEBI:138435) has role neuroprotective agent (CHEBI:63726) |
| bis(7)-tacrine (CHEBI:138435) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N,N'-di(1,2,3,4-tetrahydroacridin-9-yl)heptane-1,7-diamine |
| Synonyms | Source |
|---|---|
| B7T | ChEBI |
| bis(7)-tetrahydroaminacrine | ChEBI |
| heptylene-bis(tacrine) | ChEBI |
| N,N'-bis(1,2,3,4-tetrahydro-9-acridinyl)-1,7-heptanediamine | SUBMITTER |
| Citations |
|---|