EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H20N2S |
| Net Charge | 0 |
| Average Mass | 188.340 |
| Monoisotopic Mass | 188.13472 |
| SMILES | CCCCNC(=S)NCCCC |
| InChI | InChI=1S/C9H20N2S/c1-3-5-7-10-9(12)11-8-6-4-2/h3-8H2,1-2H3,(H2,10,11,12) |
| InChIKey | KFFQABQEJATQAT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N'-dibutylthiourea (CHEBI:138415) has role allergen (CHEBI:50904) |
| N,N'-dibutylthiourea (CHEBI:138415) is a thioureas (CHEBI:51276) |
| IUPAC Name |
|---|
| N,N'-dibutylthiourea |
| Synonyms | Source |
|---|---|
| 1,3-Dibutyl-2-thiourea | ChemIDplus |
| 1,3-Dibutylthiourea | ChemIDplus |
| 1,3-Di-n-butyl-2-thiourea | ChemIDplus |
| DBTU | ChEBI |
| N,N'-di-n-butylthiourea | ChEBI |
| s-dibutylthiourea | ChEBI |
| Citations |
|---|