EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2S |
| Net Charge | 0 |
| Average Mass | 228.320 |
| Monoisotopic Mass | 228.07212 |
| SMILES | S=C(Nc1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C13H12N2S/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1-10H,(H2,14,15,16) |
| InChIKey | FCSHMCFRCYZTRQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N'-diphenylthiourea (CHEBI:138412) has role allergen (CHEBI:50904) |
| N,N'-diphenylthiourea (CHEBI:138412) is a thioureas (CHEBI:51276) |
| IUPAC Name |
|---|
| N,N'-diphenylthiourea |
| Synonyms | Source |
|---|---|
| 1,3-Diphenylthiourea | ChemIDplus |
| Thiocarbanilide | ChemIDplus |
| 1,3-Diphenyl-2-thiourea | ChemIDplus |
| sym-diphenylthiourea | ChemIDplus |
| DPTU | ChEBI |
| diphenylthiourea | ChemIDplus |
| Citations |
|---|