EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8O2S |
| Net Charge | 0 |
| Average Mass | 120.173 |
| Monoisotopic Mass | 120.02450 |
| SMILES | O=C(O)CCCS |
| InChI | InChI=1S/C4H8O2S/c5-4(6)2-1-3-7/h7H,1-3H2,(H,5,6) |
| InChIKey | DTRIDVOOPAQEEL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-sulfanylbutanoic acid (CHEBI:138400) is a monocarboxylic acid (CHEBI:25384) |
| 4-sulfanylbutanoic acid (CHEBI:138400) is a thiol (CHEBI:29256) |
| 4-sulfanylbutanoic acid (CHEBI:138400) is conjugate acid of 4-sulfanylbutanoate (CHEBI:138358) |
| Incoming Relation(s) |
| 4,4'-disulfanyldibutanoic acid (CHEBI:138402) has functional parent 4-sulfanylbutanoic acid (CHEBI:138400) |
| 4-sulfanylbutanoate (CHEBI:138358) is conjugate base of 4-sulfanylbutanoic acid (CHEBI:138400) |
| IUPAC Name |
|---|
| 4-sulfanylbutanoic acid |
| Synonyms | Source |
|---|---|
| 4-mercaptobutanoic acid | IUPAC |
| γ-mercaptobutanoic acid | ChEBI |
| γ-mercaptobutyric acid | ChemIDplus |
| 4-mercaptobutyric acid | ChemIDplus |
| 4-sulfanylbutyric acid | ChEBI |
| γ-sulfanylbutyric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-16589 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:773863 | Reaxys |
| CAS:13095-73-3 | ChemIDplus |
| Citations |
|---|