EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H41NO5 |
| Net Charge | 0 |
| Average Mass | 447.616 |
| Monoisotopic Mass | 447.29847 |
| SMILES | [H][C@]12CC(=O)[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC(=O)NCC(=O)O)[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C26H41NO5/c1-15(4-7-22(30)27-14-23(31)32)18-5-6-19-24-20(9-11-26(18,19)3)25(2)10-8-17(28)12-16(25)13-21(24)29/h15-20,24,28H,4-14H2,1-3H3,(H,27,30)(H,31,32)/t15-,16+,17-,18-,19+,20+,24+,25+,26-/m1/s1 |
| InChIKey | MOZIKWXTNVWDAB-JPNWVCBHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-oxoglycolithocholic acid (CHEBI:138391) has functional parent glycolithocholic acid (CHEBI:37998) |
| 7-oxoglycolithocholic acid (CHEBI:138391) is a 3α-hydroxy steroid (CHEBI:36835) |
| 7-oxoglycolithocholic acid (CHEBI:138391) is a 7-oxo steroid (CHEBI:47789) |
| 7-oxoglycolithocholic acid (CHEBI:138391) is a bile acid glycine conjugate (CHEBI:36255) |
| 7-oxoglycolithocholic acid (CHEBI:138391) is conjugate acid of 7-oxoglycolithocholate (CHEBI:137818) |
| Incoming Relation(s) |
| 7-oxoglycolithocholate (CHEBI:137818) is conjugate base of 7-oxoglycolithocholic acid (CHEBI:138391) |
| IUPAC Name |
|---|
| N-[(3α,5β)-3-hydroxy-7,24-dioxocholan-24-yl]glycine |
| Synonyms | Source |
|---|---|
| {[(3α,5β)-3-hydroxy-7,24-dioxocholan-24-yl]amino}acetic acid | ChEBI |
| 7-ketoglycolithocholic acid | ChEBI |
| N-(3α-hydroxy-7-oxo-5β-cholan-24-oyl)glycine | ChEBI |
| nutriaglycocholic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3180349 | Reaxys |
| CAS:75808-00-3 | ChemIDplus |