EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:138388 - 4-methylpent-3-en-1-ol
| Formula | C6H12O |
| Net Charge | 0 |
| Average Mass | 100.161 |
| Monoisotopic Mass | 100.08882 |
| SMILES | CC(C)=CCCO |
| InChI | InChI=1S/C6H12O/c1-6(2)4-3-5-7/h4,7H,3,5H2,1-2H3 |
| InChIKey | FKKLUOCEIANSFL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aloe arborescens var. natalensis (ncbitaxon:45386) | leaf (BTO:0000713) | PubMed (10552708) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methylpent-3-en-1-ol (CHEBI:138388) has role plant metabolite (CHEBI:76924) |
| 4-methylpent-3-en-1-ol (CHEBI:138388) is a homoallylic alcohol (CHEBI:134362) |
| 4-methylpent-3-en-1-ol (CHEBI:138388) is a primary alcohol (CHEBI:15734) |
| Incoming Relation(s) |
| 4-methylpent-3-en-1-yl acetate (CHEBI:138373) has functional parent 4-methylpent-3-en-1-ol (CHEBI:138388) |
| IUPAC Name |
|---|
| 4-methylpent-3-en-1-ol |
| Synonyms | Source |
|---|---|
| 4-methyl-3-pentenol | NIST Chemistry WebBook |
| homoprenol | ChEBI |
| 4-methyl-3-penten-1-ol | ChEBI |
| 2-methyl-2-penten-5-ol | ChEBI |
| Citations |
|---|