EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H33O5 |
| Net Charge | -1 |
| Average Mass | 365.490 |
| Monoisotopic Mass | 365.23335 |
| SMILES | CCC(O)CC[C@H](O)/C=C/[C@H]1O[C@H]2C[C@H](C2)[C@@H]1C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C21H34O5/c1-2-16(22)9-10-17(23)11-12-20-19(15-13-18(14-15)26-20)7-5-3-4-6-8-21(24)25/h3,5,11-12,15-20,22-23H,2,4,6-10,13-14H2,1H3,(H,24,25)/p-1/b5-3-,12-11+/t15-,16?,17-,18+,19-,20+/m0/s1 |
| InChIKey | GQTKTVLOOUFFTJ-QLKVQSEBSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-hydroxycarbocyclic thromboxane A2(1−) (CHEBI:138324) has functional parent carbocyclic thromboxane A2(1−) (CHEBI:138322) |
| 18-hydroxycarbocyclic thromboxane A2(1−) (CHEBI:138324) is a hydroxy fatty acid anion (CHEBI:59835) |
| 18-hydroxycarbocyclic thromboxane A2(1−) (CHEBI:138324) is a thromboxane anion (CHEBI:62945) |
| 18-hydroxycarbocyclic thromboxane A2(1−) (CHEBI:138324) is conjugate base of 18-hydroxycarbocyclic thromboxane A2 (CHEBI:139046) |
| Incoming Relation(s) |
| 18-hydroxycarbocyclic thromboxane A2 (CHEBI:139046) is conjugate acid of 18-hydroxycarbocyclic thromboxane A2(1−) (CHEBI:138324) |
| IUPAC Name |
|---|
| (5Z)-7-{(1R,3R,4S,5R)-3-[(1E,3S)-3,6-dihydroxyoct-1-en-1-yl]-2-oxabicyclo[3.1.1]heptan-4-yl}hept-5-enoate |
| Synonyms | Source |
|---|---|
| 18-hydroxy-(9α,11α)-methylene TXA2(1−) | SUBMITTER |
| 18-hydroxy-(9α,11α)-methylene thromboxane A2(1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 18-hydroxy-9α,11α-methylene thromboxane A2 | UniProt |
| Citations |
|---|