EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12NO6PR2 |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 213.126 |
| Monoisotopic Mass (excl. R groups) | 213.04022 |
| SMILES | *OC[C@]([H])(COP(=O)(O)OCCN)O* |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monoalk-1-enyl-sn-glycero-3-phosphoethanolamine (CHEBI:138319) is a glycerophosphoethanolamine (CHEBI:36314) |
| monoalk-1-enyl-sn-glycero-3-phosphoethanolamine (CHEBI:138319) is tautomer of monoalk-1-enyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:77611) |
| Incoming Relation(s) |
| monoalk-1-enyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:77611) is tautomer of monoalk-1-enyl-sn-glycero-3-phosphoethanolamine (CHEBI:138319) |
| Synonym | Source |
|---|---|
| monoalk-1-enyl-sn-glycero-3-phosphoethanolamines | ChEBI |