EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26O3 |
| Net Charge | 0 |
| Average Mass | 314.425 |
| Monoisotopic Mass | 314.18819 |
| SMILES | [H][C@@]12CC[C@@H]3C[C@@]1(CC[C@]1([H])c4ccoc4C=C[C@@]21C)C[C@]3(O)CO |
| InChI | InChI=1S/C20H26O3/c1-18-7-5-16-14(6-9-23-16)15(18)4-8-19-10-13(2-3-17(18)19)20(22,11-19)12-21/h5-7,9,13,15,17,21-22H,2-4,8,10-12H2,1H3/t13-,15-,17+,18-,19+,20+/m1/s1 |
| InChIKey | JEKMKNDURXDJAD-HWUKTEKMSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coffea arabica (ncbitaxon:13443) | - | PubMed (24209317) | Isolated from green coffee oil. Strain: Catuai Amarelo variety |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kahweol (CHEBI:138308) has role angiogenesis inhibitor (CHEBI:48422) |
| kahweol (CHEBI:138308) has role anti-inflammatory agent (CHEBI:67079) |
| kahweol (CHEBI:138308) has role antineoplastic agent (CHEBI:35610) |
| kahweol (CHEBI:138308) has role antioxidant (CHEBI:22586) |
| kahweol (CHEBI:138308) has role apoptosis inducer (CHEBI:68495) |
| kahweol (CHEBI:138308) has role plant metabolite (CHEBI:76924) |
| kahweol (CHEBI:138308) is a diterpenoid (CHEBI:23849) |
| kahweol (CHEBI:138308) is a furans (CHEBI:24129) |
| kahweol (CHEBI:138308) is a organic heteropentacyclic compound (CHEBI:38164) |
| kahweol (CHEBI:138308) is a primary alcohol (CHEBI:15734) |
| kahweol (CHEBI:138308) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Names |
|---|
| (1S,4S,12S,13R,16R,17R)-17-(hydroxymethyl)-12-methyl-8-oxapentacyclo[14.2.1.01,13.04,12.05,9]nonadeca-5(9),6,10-trien-17-ol |
| (3bS,5aS,7R,8R,10aR,10bS)-7-(hydroxymethyl)-10b-methyl-3b,4,5,6,7,8,9,10,10a,10b-decahydro-5a,8-methanocyclohepta[5,6]naphtho[2,1-b]furan-7-ol |
| Synonyms | Source |
|---|---|
| CCRIS-1521 | ChEBI |
| CCRIS 1521 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| FDB014295 | FooDB |
| CPD-16468 | MetaCyc |
| HMDB0035602 | HMDB |
| Kahweol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:6894-43-5 | ChemIDplus |
| Citations |
|---|