EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | C/C(=C\CC/C=C(\C)CC/C=C(\C)CC[C@@H]1OC1(C)C)CC/C=C(\C)CC[C@@H]1OC1(C)C |
| InChI | InChI=1S/C30H50O2/c1-23(15-11-17-25(3)19-21-27-29(5,6)31-27)13-9-10-14-24(2)16-12-18-26(4)20-22-28-30(7,8)32-28/h13-14,17-18,27-28H,9-12,15-16,19-22H2,1-8H3/b23-13+,24-14+,25-17+,26-18+/t27-,28-/m0/s1 |
| InChIKey | KABSNIWLJXCBGG-OQSIWNGOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lycopodium clavatum (ncbitaxon:3252) | - | PubMed (26663356) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S,22S)-2,3:22,23-diepoxy-2,3,22,23-tetrahydrosqualene (CHEBI:138307) has role plant metabolite (CHEBI:76924) |
| (3S,22S)-2,3:22,23-diepoxy-2,3,22,23-tetrahydrosqualene (CHEBI:138307) is a epoxide (CHEBI:32955) |
| (3S,22S)-2,3:22,23-diepoxy-2,3,22,23-tetrahydrosqualene (CHEBI:138307) is a squalene triterpenoid (CHEBI:26747) |
| IUPAC Name |
|---|
| (2S,2'S)-2,2'-[(3E,7E,11E,15E)-3,7,12,16-tetramethyloctadeca-3,7,11,15-tetraene-1,18-diyl]bis(3,3-dimethyloxirane) |
| Synonym | Source |
|---|---|
| (3S,22S)-2,3:22,23-dioxidosqualene | ChEBI |
| UniProt Name | Source |
|---|---|
| (3S,22S)-2,3:22,23-diepoxysqualene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20473 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8657029 | Reaxys |
| Citations |
|---|