EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@@]12CCC(=C)[C@H](CC/C=C(\C)CC/C=C(\C)CC[C@@H]3OC3(C)C)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C30H50O2/c1-21(11-9-12-22(2)15-18-27-29(6,7)32-27)13-10-14-24-23(3)16-17-25-28(4,5)26(31)19-20-30(24,25)8/h12-13,24-27,31H,3,9-11,14-20H2,1-2,4-8H3/b21-13+,22-12+/t24-,25-,26-,27-,30+/m0/s1 |
| InChIKey | YOXYJGZFQYXPHZ-AEBUGLRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lycopodium clavatum (ncbitaxon:3252) | - | PubMed (26663356) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (21S)-21,22-epoxypolypoda-8(26)-13,17-trien-3β-ol (CHEBI:138305) has role plant metabolite (CHEBI:76924) |
| (21S)-21,22-epoxypolypoda-8(26)-13,17-trien-3β-ol (CHEBI:138305) is a carbobicyclic compound (CHEBI:36785) |
| (21S)-21,22-epoxypolypoda-8(26)-13,17-trien-3β-ol (CHEBI:138305) is a epoxide (CHEBI:32955) |
| (21S)-21,22-epoxypolypoda-8(26)-13,17-trien-3β-ol (CHEBI:138305) is a olefinic compound (CHEBI:78840) |
| (21S)-21,22-epoxypolypoda-8(26)-13,17-trien-3β-ol (CHEBI:138305) is a secondary alcohol (CHEBI:35681) |
| (21S)-21,22-epoxypolypoda-8(26)-13,17-trien-3β-ol (CHEBI:138305) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| (2S,4aR,5S,8aR)-5-{(3E,7E)-10-[(2S)-3,3-dimethyloxiran-2-yl]-4,8-dimethyldeca-3,7-dien-1-yl}-1,1,4a-trimethyl-6-methylidenedecahydronaphthalen-2-ol |
| Synonym | Source |
|---|---|
| polypoda-8(26),13,17-trien-21,22-epoxy-3β-ol | ChEBI |
| UniProt Name | Source |
|---|---|
| pre-α-onocerin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20474 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29170306 | Reaxys |
| Citations |
|---|