EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | [H][C@@]12CCC(C)=C(CCC3=C(C)CC[C@@]4([H])C(C)(C)[C@@H](O)CC[C@]34C)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C30H50O2/c1-19-9-13-23-27(3,4)25(31)15-17-29(23,7)21(19)11-12-22-20(2)10-14-24-28(5,6)26(32)16-18-30(22,24)8/h23-26,31-32H,9-18H2,1-8H3/t23-,24-,25-,26-,29+,30+/m0/s1 |
| InChIKey | CNHOGQMRRDHYGI-NJCGARBWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lycopodium clavatum (ncbitaxon:3252) | - | PubMed (26663356) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-onocerin (CHEBI:138304) has role plant metabolite (CHEBI:76924) |
| β-onocerin (CHEBI:138304) is a diol (CHEBI:23824) |
| β-onocerin (CHEBI:138304) is a olefinic compound (CHEBI:78840) |
| β-onocerin (CHEBI:138304) is a secondary alcohol (CHEBI:35681) |
| β-onocerin (CHEBI:138304) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| (2S,4aS,8aR,2'S,4a'S,8a'R)-5,5'-(ethane-1,2-diyl)bis(1,1,4a,6-tetramethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-2-ol) |
| Synonyms | Source |
|---|---|
| (3β,21α)-8,14-secogammacera-8,13-diene-3,21-diol | ChemIDplus |
| Onocerin | ChemIDplus |
| Citations |
|---|