EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O3 |
| Net Charge | 0 |
| Average Mass | 298.467 |
| Monoisotopic Mass | 298.25079 |
| SMILES | CCCCCCCC[C@H]1O[C@H]1CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h16-17H,2-15H2,1H3,(H,19,20)/t16-,17+/m1/s1 |
| InChIKey | IMYZYCNQZDBZBQ-SJORKVTESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9S,10R)-epoxyoctadecanoic acid (CHEBI:138262) is a cis-9,10-epoxyoctadecanoic acid (CHEBI:82464) |
| (9S,10R)-epoxyoctadecanoic acid (CHEBI:138262) is conjugate acid of (9S,10R)-epoxyoctadecanoate (CHEBI:137461) |
| (9S,10R)-epoxyoctadecanoic acid (CHEBI:138262) is enantiomer of (9R,10S)-9,10-epoxyoctadecanoic acid (CHEBI:138260) |
| Incoming Relation(s) |
| (9S,10R)-epoxyoctadecanoate (CHEBI:137461) is conjugate base of (9S,10R)-epoxyoctadecanoic acid (CHEBI:138262) |
| (9R,10S)-9,10-epoxyoctadecanoic acid (CHEBI:138260) is enantiomer of (9S,10R)-epoxyoctadecanoic acid (CHEBI:138262) |
| IUPAC Name |
|---|
| 8-[(2S,3R)-3-octyloxiran-2-yl]octanoic acid |
| Synonym | Source |
|---|---|
| (9S,10R)-epoxystearic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA02000001 | LIPID MAPS |
| Citations |
|---|