EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27O11 |
| Net Charge | 0 |
| Average Mass | 407.392 |
| Monoisotopic Mass | 407.15534 |
| SMILES | *[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[C@@H]2O[C@@H](C)[C@@H](OC(C)=O)[C@@H](OC)[C@H]2OC(C)=O)[C@H]1O |
| Roles Classification |
|---|
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-deoxy-α-L-Talp2,3Ac2-(1→3)-β-D-Glcp-yl group (CHEBI:138259) has role epitope (CHEBI:53000) |
| 6-deoxy-α-L-Talp2,3Ac2-(1→3)-β-D-Glcp-yl group (CHEBI:138259) is a glycosyl group (CHEBI:24403) |
| IUPAC Name |
|---|
| 2,4-di-O-acetyl-6-deoxy-3-O-methyl-α-L-talopyranosyl-(1→3)-β-D-glucopyranosyl |
| Synonyms | Source |
|---|---|
| 2,4-di-O-acetyl-6-deoxy-3-O-methyl-α-L-talosyl-(1→3)-β-D-glucosyl | ChEBI |
| 3-O-(2,4-di-O-acetyl-6-deoxy-3-O-methyl-α-L-talopyranosyl)-β-D-glucopyranosyl | IUPAC |
| 3-O-(2,4-di-O-acetyl-6-deoxy-3-O-methyl-α-L-talopyranosyl)-β-D-glucopyranosyl group | ChEBI |
| 6-deoxy-α-L-Tal2,3Ac2-(1→3)-β-D-Glc-yl | ChEBI |
| 6-deoxy-α-L-Tal2,3Ac2-(1→3)-β-D-Glc-yl group | ChEBI |
| Citations |
|---|