EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O4 |
| Net Charge | 0 |
| Average Mass | 314.466 |
| Monoisotopic Mass | 314.24571 |
| SMILES | O=C(O)CCCCCCC[C@@H]1O[C@@H]1CCCCCCCCO |
| InChI | InChI=1S/C18H34O4/c19-15-11-7-2-1-4-8-12-16-17(22-16)13-9-5-3-6-10-14-18(20)21/h16-17,19H,1-15H2,(H,20,21)/t16-,17+/m1/s1 |
| InChIKey | ITTPZDMHCNGAGQ-SJORKVTESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9S,10R)-9,10-epoxy-18-hydroxyoctadecanoic acid (CHEBI:138255) is a 9,10-epoxy-18-hydroxyoctadecanoic acid (CHEBI:133381) |
| (9S,10R)-9,10-epoxy-18-hydroxyoctadecanoic acid (CHEBI:138255) is conjugate acid of (9S,10R)-9,10-epoxy-18-hydroxyoctadecanoate (CHEBI:137458) |
| (9S,10R)-9,10-epoxy-18-hydroxyoctadecanoic acid (CHEBI:138255) is enantiomer of (9R,10S)-9,10-epoxy-18-hydroxyoctadecanoic acid (CHEBI:138258) |
| Incoming Relation(s) |
| (9S,10R)-9,10-epoxy-18-hydroxyoctadecanoate (CHEBI:137458) is conjugate base of (9S,10R)-9,10-epoxy-18-hydroxyoctadecanoic acid (CHEBI:138255) |
| (9R,10S)-9,10-epoxy-18-hydroxyoctadecanoic acid (CHEBI:138258) is enantiomer of (9S,10R)-9,10-epoxy-18-hydroxyoctadecanoic acid (CHEBI:138255) |
| IUPAC Name |
|---|
| 8-[(2S,3R)-3-(8-hydroxyoctyl)oxiran-2-yl]octanoic acid |
| Synonyms | Source |
|---|---|
| 18-hydroxy-(9S,10R)-9,10-epoxy-octadecanoic acid | ChEBI |
| (9S,10R)-9,10-epoxy-18-hydroxystearic acid | ChEBI |
| 18-hydroxy-(9S,10R)-9,10-epoxystearic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25842901 | Reaxys |
| Citations |
|---|