EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | CC(=O)CC(O)C(C)=O |
| InChI | InChI=1S/C6H10O3/c1-4(7)3-6(9)5(2)8/h6,9H,3H2,1-2H3 |
| InChIKey | MXGSILCFPNVDMX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saussurea katochaete (ncbitaxon:238945) | whole plant (BTO:0001461) | PubMed (17944328) | From acetone extract of whole plant |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyhexane-2,5-dione (CHEBI:138251) has role plant metabolite (CHEBI:76924) |
| 3-hydroxyhexane-2,5-dione (CHEBI:138251) is a diketone (CHEBI:46640) |
| 3-hydroxyhexane-2,5-dione (CHEBI:138251) is a secondary α-hydroxy ketone (CHEBI:2468) |
| 3-hydroxyhexane-2,5-dione (CHEBI:138251) is a β-hydroxy ketone (CHEBI:55380) |
| IUPAC Name |
|---|
| 3-hydroxyhexane-2,5-dione |
| Synonyms | Source |
|---|---|
| 3-hydroxy-2,5-hexanedione | ChEBI |
| 3-hydroxy-hexane-2,5-dione | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-hydroxyhexane-2,5-dione | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1756899 | Reaxys |
| Citations |
|---|