EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32O4 |
| Net Charge | 0 |
| Average Mass | 360.494 |
| Monoisotopic Mass | 360.23006 |
| SMILES | CC/C=C\C/C=C\C[C@H](O)/C=C\C=C\C=C\[C@H](O)C/C=C\CCC(=O)O |
| InChI | InChI=1S/C22H32O4/c1-2-3-4-5-6-10-15-20(23)16-11-7-8-12-17-21(24)18-13-9-14-19-22(25)26/h3-4,6-13,16-17,20-21,23-24H,2,5,14-15,18-19H2,1H3,(H,25,26)/b4-3-,8-7+,10-6-,13-9-,16-11-,17-12+/t20-,21-/m0/s1 |
| InChIKey | HLHYXXBCQOUTGK-FHCQLJOMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. hepatoprotective agent Any compound that is able to prevent damage to the liver. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7R,14S)-dihydroxy-(4Z,8E,10E,12Z,16Z,19Z)-docosahexaenoic acid (CHEBI:138249) has functional parent all-cis-docosa-4,7,10,13,16,19-hexaenoic acid (CHEBI:28125) |
| (7R,14S)-dihydroxy-(4Z,8E,10E,12Z,16Z,19Z)-docosahexaenoic acid (CHEBI:138249) has role anti-inflammatory agent (CHEBI:67079) |
| (7R,14S)-dihydroxy-(4Z,8E,10E,12Z,16Z,19Z)-docosahexaenoic acid (CHEBI:138249) has role hepatoprotective agent (CHEBI:62868) |
| (7R,14S)-dihydroxy-(4Z,8E,10E,12Z,16Z,19Z)-docosahexaenoic acid (CHEBI:138249) has role human xenobiotic metabolite (CHEBI:76967) |
| (7R,14S)-dihydroxy-(4Z,8E,10E,12Z,16Z,19Z)-docosahexaenoic acid (CHEBI:138249) has role specialised pro-resolving mediator (CHEBI:140399) |
| (7R,14S)-dihydroxy-(4Z,8E,10E,12Z,16Z,19Z)-docosahexaenoic acid (CHEBI:138249) is a dihydroxydocosahexaenoic acid (CHEBI:137348) |
| (7R,14S)-dihydroxy-(4Z,8E,10E,12Z,16Z,19Z)-docosahexaenoic acid (CHEBI:138249) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| (4Z,7R,8E,10E,12Z,14S,16Z,19Z)-7,14-dihydroxydocosa-4,8,10,12,16,19-hexaenoic acid |
| Synonyms | Source |
|---|---|
| (4Z,7R,8E,10E,12Z,14S,16Z,19Z)-7,14-dihydroxydocosahexaenoic acid | ChEBI |
| MaR1 | ChEBI |
| maresin 1 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Maresin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21813987 | Reaxys |
| Citations |
|---|