EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | [H][C@]12CCC(C(C)C)=C[C@@]13OC(=O)[C@@]21CCCC(C)(C)[C@]1([H])C[C@H]3O |
| InChI | InChI=1S/C20H30O3/c1-12(2)13-6-7-14-19-9-5-8-18(3,4)15(19)10-16(21)20(14,11-13)23-17(19)22/h11-12,14-16,21H,5-10H2,1-4H3/t14-,15+,16-,19+,20-/m1/s1 |
| InChIKey | XAPXKNWMZURWMY-VQEGESQYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon rubescens (ncbitaxon:587669) | leaf (BTO:0000713) | PubMed (22565549) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rubesanolide D (CHEBI:138243) has role antibacterial agent (CHEBI:33282) |
| rubesanolide D (CHEBI:138243) has role plant metabolite (CHEBI:76924) |
| rubesanolide D (CHEBI:138243) is a abietane diterpenoid (CHEBI:36762) |
| rubesanolide D (CHEBI:138243) is a olefinic compound (CHEBI:78840) |
| rubesanolide D (CHEBI:138243) is a secondary alcohol (CHEBI:35681) |
| rubesanolide D (CHEBI:138243) is a tetracyclic diterpenoid (CHEBI:52557) |
| rubesanolide D (CHEBI:138243) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| 7α-hydroxy-8,20-epoxyabiet-13-en-20-one |
| UniProt Name | Source |
|---|---|
| rubesanolide D | UniProt |
| Citations |
|---|