EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O6 |
| Net Charge | 0 |
| Average Mass | 364.438 |
| Monoisotopic Mass | 364.18859 |
| SMILES | [H][C@]12CC[C@H]3[C@@]45CO[C@](O)([C@@H](O)[C@]4([H])C(C)(C)CC[C@@H]5O)[C@@]3(C(=O)C1=C)[C@@H]2O |
| InChI | InChI=1S/C20H28O6/c1-9-10-4-5-11-18-8-26-20(25,19(11,14(9)22)15(10)23)16(24)13(18)17(2,3)7-6-12(18)21/h10-13,15-16,21,23-25H,1,4-8H2,2-3H3/t10-,11-,12-,13+,15+,16-,18+,19-,20+/m0/s1 |
| InChIKey | SDHTXBWLVGWJFT-XKCURVIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon rubescens (ncbitaxon:587669) | leaf (BTO:0000713) | PubMed (28259901) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-asthmatic agent Any compound that has anti-asthmatic effects. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oridonin (CHEBI:138236) has role angiogenesis inhibitor (CHEBI:48422) |
| oridonin (CHEBI:138236) has role anti-asthmatic agent (CHEBI:65023) |
| oridonin (CHEBI:138236) has role antibacterial agent (CHEBI:33282) |
| oridonin (CHEBI:138236) has role antineoplastic agent (CHEBI:35610) |
| oridonin (CHEBI:138236) has role apoptosis inducer (CHEBI:68495) |
| oridonin (CHEBI:138236) has role plant metabolite (CHEBI:76924) |
| oridonin (CHEBI:138236) is a ent-kaurane diterpenoid (CHEBI:36760) |
| oridonin (CHEBI:138236) is a cyclic hemiketal (CHEBI:59780) |
| oridonin (CHEBI:138236) is a enone (CHEBI:51689) |
| oridonin (CHEBI:138236) is a organic heteropentacyclic compound (CHEBI:38164) |
| oridonin (CHEBI:138236) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1α,5β,6β,7α,8α,9β,10α,13α,14R)-1,6,7,14-tetrahydroxy-7,20-epoxykaur-16-en-15-one |
| Synonyms | Source |
|---|---|
| (1α,6β,7α,14R)-7,20-epoxy-1,6,7,14-tetrahydroxykaur-16-en-15-one | ChemIDplus |
| isodonol | ChemIDplus |
| oridonine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00033270 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1691227 | Reaxys |
| CAS:28957-04-2 | ChemIDplus |
| Citations |
|---|