EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | [H][C@@]12CC[C@@H](C)[C@]3(CC[C@](C)(C=C)O3)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H34O/c1-7-18(5)13-14-20(21-18)15(2)9-10-16-17(3,4)11-8-12-19(16,20)6/h7,15-16H,1,8-14H2,2-6H3/t15-,16+,18+,19+,20-/m1/s1 |
| InChIKey | YFIVBYGSVFHTOP-XIHRTOKZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Marrubium vulgare (ncbitaxon:41230) | - | PubMed (24990389) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,13(R)-epoxylabd-14-ene (CHEBI:138233) has role plant metabolite (CHEBI:76924) |
| 9,13(R)-epoxylabd-14-ene (CHEBI:138233) is a labdane diterpenoid (CHEBI:36770) |
| 9,13(R)-epoxylabd-14-ene (CHEBI:138233) is a oxaspiro compound (CHEBI:37948) |
| 9,13(R)-epoxylabd-14-ene (CHEBI:138233) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| (1R,2R,4aS,5'R,8aS)-5'-ethenyl-2,5,5,5',8a-pentamethyloctahydro-2H-spiro[naphthalene-1,2'-oxolane] |
| UniProt Name | Source |
|---|---|
| (13R)-9,13-epoxylabd-14-ene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20437 | MetaCyc |
| Citations |
|---|