EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:138224 - (13R)-epi-8,13-epoxylabd-14-ene
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | [H][C@@]12CC[C@](C)(C=C)O[C@@]1(C)CC[C@]1([H])C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C20H34O/c1-7-18(4)13-9-16-19(5)12-8-11-17(2,3)15(19)10-14-20(16,6)21-18/h7,15-16H,1,8-14H2,2-6H3/t15-,16+,18+,19-,20+/m1/s1 |
| InChIKey | IGGWKHQYMAJOHK-QVHQYWGISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cistus monspeliensis (ncbitaxon:335184) | |||
| leaf (BTO:0000713) | PubMed (11301869) | ||
| fruit (BTO:0000486) | PubMed (11301869) | ||
| Phaeosphaeria sp. (ncbitaxon:65784) | - | PubMed (15564689) | Strain: L487 |
| Cistus incanus subsp. creticus (ncbitaxon:393199) | - | DOI (10.1080/10412905.1994.9698322) | Obtained from the essential oil |
| Cistus creticus (ncbitaxon:191224) | rhizome (BTO:0001181) | PubMed (17236091) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (13R)-epi-8,13-epoxylabd-14-ene (CHEBI:138224) has role antibacterial agent (CHEBI:33282) |
| (13R)-epi-8,13-epoxylabd-14-ene (CHEBI:138224) has role fungal metabolite (CHEBI:76946) |
| (13R)-epi-8,13-epoxylabd-14-ene (CHEBI:138224) has role plant metabolite (CHEBI:76924) |
| (13R)-epi-8,13-epoxylabd-14-ene (CHEBI:138224) is a cyclic ether (CHEBI:37407) |
| (13R)-epi-8,13-epoxylabd-14-ene (CHEBI:138224) is a labdane diterpenoid (CHEBI:36770) |
| (13R)-epi-8,13-epoxylabd-14-ene (CHEBI:138224) is a organic heterotricyclic compound (CHEBI:26979) |
| (13R)-epi-8,13-epoxylabd-14-ene (CHEBI:138224) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| (3R,4aS,6aR,10aR,10bS)-3-ethenyl-3,4a,7,7,10a-pentamethyldodecahydro-1H-naphtho[2,1-b]pyran |
| Synonym | Source |
|---|---|
| (-)-ent-13-epi-Manoyl oxide | KNApSAcK |
| UniProt Name | Source |
|---|---|
| ent-13-epi-manoyl oxide | UniProt |
| Citations |
|---|