EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23N3O15P2 |
| Net Charge | 0 |
| Average Mass | 535.292 |
| Monoisotopic Mass | 535.06044 |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@@H](O)[C@@H](O)C(=O)CO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C14H23N3O15P2/c15-9-1-2-17(14(24)16-9)13-12(23)11(22)8(31-13)5-30-34(27,28)32-33(25,26)29-4-7(20)10(21)6(19)3-18/h1-2,7-8,10-13,18,20-23H,3-5H2,(H,25,26)(H,27,28)(H2,15,16,24)/t7-,8-,10+,11-,12-,13-/m1/s1 |
| InChIKey | CPZOFDVOYWJRNZ-RXSOLEHHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CDP-D-ribulose (CHEBI:138221) has functional parent D-ribulose (CHEBI:17173) |
| CDP-D-ribulose (CHEBI:138221) is a CDP-sugar (CHEBI:20873) |
| CDP-D-ribulose (CHEBI:138221) is a secondary α-hydroxy ketone (CHEBI:2468) |
| CDP-D-ribulose (CHEBI:138221) is conjugate acid of CDP-D-ribulose(2−) (CHEBI:137524) |
| Incoming Relation(s) |
| CDP-D-ribulose(2−) (CHEBI:137524) is conjugate base of CDP-D-ribulose (CHEBI:138221) |
| Citations |
|---|