EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | [H][C@@]12C[C@@H]3CC[C@@]1(CC[C@]1([H])C(C)(C)CCC[C@@]21C)CC3=C |
| InChI | InChI=1S/C20H32/c1-14-13-20-10-6-15(14)12-17(20)19(4)9-5-8-18(2,3)16(19)7-11-20/h15-17H,1,5-13H2,2-4H3/t15-,16+,17-,19+,20+/m0/s1 |
| InChIKey | LFRRHLVVLXYROS-YQXATGRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Araucaria araucana (ncbitaxon:42754) | - | DOI (10.1016/0040-4020(75)80175-X) | Found in essential oil |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-atiserene (CHEBI:138219) has role plant metabolite (CHEBI:76924) |
| ent-atiserene (CHEBI:138219) is a diterpene (CHEBI:35190) |
| ent-atiserene (CHEBI:138219) is a olefinic compound (CHEBI:78840) |
| ent-atiserene (CHEBI:138219) is a polycyclic hydrocarbon (CHEBI:33666) |
| IUPAC Name |
|---|
| (5β,8α,9β,10α,12α)-atis-16-ene |
| Synonyms | Source |
|---|---|
| ent-atiser-16-ene | ChEBI |
| (−)-atisirene | ChEBI |
| UniProt Name | Source |
|---|---|
| ent-atiserene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2559115 | Reaxys |
| CAS:20230-48-2 | KNApSAcK |
| CAS:20230-48-2 | NIST Chemistry WebBook |
| Citations |
|---|