EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H47N3O9S |
| Net Charge | 0 |
| Average Mass | 649.807 |
| Monoisotopic Mass | 649.30330 |
| SMILES | CC/C=C\C/C=C\C[C@H](O)[C@@H](/C=C/C=C/C=C\C/C=C\CCC(=O)O)SC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C32H47N3O9S/c1-2-3-4-5-11-14-17-26(36)27(18-15-12-9-7-6-8-10-13-16-19-29(38)39)45-23-25(31(42)34-22-30(40)41)35-28(37)21-20-24(33)32(43)44/h3-4,6-7,9-15,18,24-27,36H,2,5,8,16-17,19-23,33H2,1H3,(H,34,42)(H,35,37)(H,38,39)(H,40,41)(H,43,44)/b4-3-,7-6-,12-9+,13-10-,14-11-,18-15+/t24-,25-,26-,27+/m0/s1 |
| InChIKey | NWYKIASJHFGEAN-CPMAONNBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (27791009) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (13R)-S-glutathionyl-(14 |
| (13R)-S-glutathionyl-(14 |
| (13R)-S-glutathionyl-(14 |
| (13R)-S-glutathionyl-(14 |
| (13R)-S-glutathionyl-(14 |
| (13R)-S-glutathionyl-(14 |
| (13R)-S-glutathionyl-(14 |
| Incoming Relation(s) |
| (13R)-S-glutathionyl-(14 |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-[(3Z,6Z,9 |
| Synonym | Source |
|---|---|
| MCTR1 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:28337237 | Reaxys |
| Citations |
|---|