EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O5 |
| Net Charge | 0 |
| Average Mass | 352.471 |
| Monoisotopic Mass | 352.22497 |
| SMILES | CC(O)CCC/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H32O5/c1-17(21)11-6-2-3-7-12-18(22)13-8-4-5-9-14-19(23)15-10-16-20(24)25/h3-5,7-9,13-14,17-19,21-23H,2,6,10-12,15-16H2,1H3,(H,24,25)/b5-4+,7-3-,13-8+,14-9-/t17?,18-,19-/m1/s1 |
| InChIKey | XZKUIIFETKOPRD-VUKNTZOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (24632148) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (2508746) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-hydroxyleukotriene B4 (CHEBI:138196) has functional parent leukotriene B4 (CHEBI:15647) |
| 19-hydroxyleukotriene B4 (CHEBI:138196) has role mouse metabolite (CHEBI:75771) |
| 19-hydroxyleukotriene B4 (CHEBI:138196) has role rat metabolite (CHEBI:86264) |
| 19-hydroxyleukotriene B4 (CHEBI:138196) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| 19-hydroxyleukotriene B4 (CHEBI:138196) is a leukotriene (CHEBI:25029) |
| 19-hydroxyleukotriene B4 (CHEBI:138196) is a long-chain fatty acid (CHEBI:15904) |
| 19-hydroxyleukotriene B4 (CHEBI:138196) is a secondary allylic alcohol (CHEBI:134396) |
| 19-hydroxyleukotriene B4 (CHEBI:138196) is a triol (CHEBI:27136) |
| 19-hydroxyleukotriene B4 (CHEBI:138196) is conjugate acid of 19-hydroxyleukotriene B4(1−) (CHEBI:137390) |
| Incoming Relation(s) |
| 19-hydroxyleukotriene B4(1−) (CHEBI:137390) is conjugate base of 19-hydroxyleukotriene B4 (CHEBI:138196) |
| IUPAC Name |
|---|
| (5S,6Z,8E,10E,12R,14Z)-5,12,19-trihydroxyicosa-6,8,10,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| 19-hydroxy-LTB4 | ChEBI |
| 19-OH-LTB(4) | ChEBI |
| 19-OH-LTB4 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| NZ553982 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4323531 | Reaxys |
| Citations |
|---|