EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40NO8P |
| Net Charge | 0 |
| Average Mass | 453.513 |
| Monoisotopic Mass | 453.24915 |
| SMILES | CCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCC |
| InChI | InChI=1S/C20H40NO8P/c1-6-8-10-12-19(22)26-16-18(29-20(23)13-11-9-7-2)17-28-30(24,25)27-15-14-21(3,4)5/h18H,6-17H2,1-5H3/t18-/m1/s1 |
| InChIKey | DVZARZBAWHITHR-GOSISDBHSA-N |
| Roles Classification |
|---|
| Chemical Role: | surfactant A substance which lowers the surface tension of the medium in which it is dissolved, and/or the interfacial tension with other phases, and, accordingly, is positively adsorbed at the liquid/vapour and/or at other interfaces. |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dihexanoyl-sn-glycero-3-phosphocholine (CHEBI:138194) has functional parent hexanoic acid (CHEBI:30776) |
| 1,2-dihexanoyl-sn-glycero-3-phosphocholine (CHEBI:138194) has role surfactant (CHEBI:35195) |
| 1,2-dihexanoyl-sn-glycero-3-phosphocholine (CHEBI:138194) is a phosphatidylcholine 12:0 (CHEBI:134298) |
| IUPAC Name |
|---|
| (2R)-2,3-bis(hexanoyloxy)propyl 2-(trimethylazaniumyl)ethyl phosphate |
| Synonyms | Source |
|---|---|
| PC(6:0/6:0) | SUBMITTER |
| phosphatidylcholine (6:0/6:0) | ChEBI |
| UniProt Name | Source |
|---|---|
| 1,2-dihexanoyl-sn-glycero-3-phosphocholine | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3723983 | Reaxys |
| Citations |
|---|