EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O6S2 |
| Net Charge | 0 |
| Average Mass | 240.258 |
| Monoisotopic Mass | 239.97623 |
| SMILES | O=C(O)C1(O)CSC(O)(C(=O)O)CS1 |
| InChI | InChI=1S/C6H8O6S2/c7-3(8)5(11)1-13-6(12,2-14-5)4(9)10/h11-12H,1-2H2,(H,7,8)(H,9,10) |
| InChIKey | GYZMXMSJOZUNEQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. antidote to cyanide poisoning A role borne by a molecule that acts to counteract or neutralize the deleterious effects of cyanide. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sulfanegen (CHEBI:138170) has role antidote to cyanide poisoning (CHEBI:90749) |
| sulfanegen (CHEBI:138170) has role prodrug (CHEBI:50266) |
| sulfanegen (CHEBI:138170) is a dicarboxylic acid (CHEBI:35692) |
| sulfanegen (CHEBI:138170) is a dithianes (CHEBI:51652) |
| sulfanegen (CHEBI:138170) is a monothiohemiketal (CHEBI:59801) |
| IUPAC Name |
|---|
| 2,5-dihydroxy-1,4-dithiane-2,5-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 24830990 | PubChem Compound |
| US2016354341 | Patent |
| WO2011133893 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21914042 | Reaxys |
| CAS:80003-64-1 | ChemIDplus |
| Citations |
|---|