EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | [H][C@]12CC[C@](C)(C=C)C[C@]1(O)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C20H34O/c1-6-18(4)12-8-16-19(5)11-7-10-17(2,3)15(19)9-13-20(16,21)14-18/h6,15-16,21H,1,7-14H2,2-5H3/t15-,16+,18-,19-,20+/m0/s1 |
| InChIKey | IYDAPILQPCDHTO-HHUCQEJWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Callitropsis vietnamensis (ncbitaxon:257623) | leaf (BTO:0000713) | PubMed (AGR:IND43895555) | Found in essential oil from leaves |
| Cryptomeria japonica (ncbitaxon:3369) | leaf (BTO:0000713) | PubMed (23714012) | Found in essential oil from leaves |
| Hesperocyparis arizonica (ncbitaxon:49011) | leaf (BTO:0000713) | PubMed (AGR:IND20603548) | Found in leaf oil |
| Isodon rubescens (ncbitaxon:58766) | leaf (BTO:0000713) | PubMed (28445526) | |
| Taxodium distichum (ncbitaxon:28982) | heartwood (PO:0004512) | PubMed (24276129) | |
| Thuja standishii (ncbitaxon:89194) | - | Article (J. Pharm. Soc. Japan, 1970, v91, 664) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nezukol (CHEBI:138166) has role antioxidant (CHEBI:22586) |
| nezukol (CHEBI:138166) has role plant metabolite (CHEBI:76924) |
| nezukol (CHEBI:138166) has role volatile oil component (CHEBI:27311) |
| nezukol (CHEBI:138166) is a carbotricyclic compound (CHEBI:38032) |
| nezukol (CHEBI:138166) is a isopimarane diterpenoid (CHEBI:138429) |
| nezukol (CHEBI:138166) is a olefinic compound (CHEBI:78840) |
| nezukol (CHEBI:138166) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (13α)-pimar-15-en-8-ol |
| Synonyms | Source |
|---|---|
| 8β-hydroxyisopimar-15-ene | ChEBI |
| 8β-hydroxyisopimarene | NIST Chemistry WebBook |
| isopimar-15-en-8-ol | ChEBI |
| UniProt Name | Source |
|---|---|
| nezukol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20251 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2376046 | Reaxys |
| CAS:14699-32-2 | NIST Chemistry WebBook |
| Citations |
|---|