EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H9ClF3N2O6S.Na |
| Net Charge | 0 |
| Average Mass | 460.749 |
| Monoisotopic Mass | 459.97196 |
| SMILES | CS(=O)(=O)[N-]C(=O)c1cc(Oc2ccc(C(F)(F)F)cc2Cl)ccc1[N+](=O)[O-].[Na+] |
| InChI | InChI=1S/C15H10ClF3N2O6S.Na/c1-28(25,26)20-14(22)10-7-9(3-4-12(10)21(23)24)27-13-5-2-8(6-11(13)16)15(17,18)19;/h2-7H,1H3,(H,20,22);/q;+1/p-1 |
| InChIKey | CRHGSCXKJPJNAB-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fomesafen-sodium (CHEBI:138164) has part fomesafen(1−) (CHEBI:138163) |
| fomesafen-sodium (CHEBI:138164) has role agrochemical (CHEBI:33286) |
| fomesafen-sodium (CHEBI:138164) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| fomesafen-sodium (CHEBI:138164) has role herbicide (CHEBI:24527) |
| fomesafen-sodium (CHEBI:138164) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium {5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl}(methylsulfonyl)azanide |
| Synonyms | Source |
|---|---|
| sodium {5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoyl}(methanesulfonyl)azanide | Alan Wood's Pesticides |
| sodium [5-(2-chloro-α,α,α-trifluoro-p-tolyloxy)-2-nitrobenzoyl]mesylazanide | Alan Wood's Pesticides |
| fomesafen sodium | ChemIDplus |
| sodium fomesafen | ChemIDplus |
| 5-[2-chloro-4-(trifluoromethyl)phenoxy]-N-(methylsulfonyl)-2-nitrobenzamide sodium salt | ChEBI |
| Brand Names | Source |
|---|---|
| Flex sodium | ChemIDplus |
| Reflex | ChEBI |
| Flex | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| derivatives/fomesafen-sodium | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9310032 | Reaxys |
| CAS:108731-70-0 | Alan Wood's Pesticides |
| CAS:108731-70-0 | ChemIDplus |
| Citations |
|---|