EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O4 |
| Net Charge | 0 |
| Average Mass | 336.472 |
| Monoisotopic Mass | 336.23006 |
| SMILES | CCCCC[C@@H]1O[C@@H]1/C=C/C(O)C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-2-3-9-13-18-19(24-18)16-15-17(21)12-10-7-5-4-6-8-11-14-20(22)23/h4,6-7,10,15-19,21H,2-3,5,8-9,11-14H2,1H3,(H,22,23)/b6-4-,10-7-,16-15+/t17?,18-,19+/m0/s1 |
| InChIKey | WLMZMBKVRPUYIG-OSPXAYQASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (8555216) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11 hydroxy-(14R,15S)-epoxy-(5Z,8Z,12E)-icosatrienoic acid (CHEBI:138149) has role rat metabolite (CHEBI:86264) |
| 11 hydroxy-(14R,15S)-epoxy-(5Z,8Z,12E)-icosatrienoic acid (CHEBI:138149) is a epoxy(hydroxy)icosatrienoic acid (CHEBI:138138) |
| 11 hydroxy-(14R,15S)-epoxy-(5Z,8Z,12E)-icosatrienoic acid (CHEBI:138149) is a secondary allylic alcohol (CHEBI:134396) |
| 11 hydroxy-(14R,15S)-epoxy-(5Z,8Z,12E)-icosatrienoic acid (CHEBI:138149) is conjugate acid of 11 hydroxy-(14R,15S)-epoxy-(5Z,8Z,12E)-icosatrienoate (CHEBI:137362) |
| Incoming Relation(s) |
| 11 hydroxy-(14R,15S)-epoxy-(5Z,8Z,12E)-icosatrienoate (CHEBI:137362) is conjugate base of 11 hydroxy-(14R,15S)-epoxy-(5Z,8Z,12E)-icosatrienoic acid (CHEBI:138149) |
| IUPAC Name |
|---|
| (5Z,8Z,12E)-11-hydroxy-13-[(2R,3S)-3-pentyloxiran-2-yl]trideca-5,8,12-trienoic acid |
| Synonyms | Source |
|---|---|
| 11-H-14,15-EETA | ChEBI |
| 11 hydroxy-(14R,15S)-epoxy-(5Z,8Z,12E)-eicosatrienoic acid | ChEBI |
| Citations |
|---|