EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H16N2O3 |
| Net Charge | 0 |
| Average Mass | 188.227 |
| Monoisotopic Mass | 188.11609 |
| SMILES | CC(=O)NCCC[C@H](N)CC(=O)O |
| InChI | InChI=1S/C8H16N2O3/c1-6(11)10-4-2-3-7(9)5-8(12)13/h7H,2-5,9H2,1H3,(H,10,11)(H,12,13)/t7-/m0/s1 |
| InChIKey | MBZWIPOSTWTKSV-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus subtilis (ncbitaxon:1423) | - | PubMed (21538109) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-6-acetamido-3-aminohexanoic acid (CHEBI:138105) has role bacterial metabolite (CHEBI:76969) |
| (S)-6-acetamido-3-aminohexanoic acid (CHEBI:138105) is a 6-acetamido-3-aminohexanoic acid (CHEBI:2164) |
| (S)-6-acetamido-3-aminohexanoic acid (CHEBI:138105) is tautomer of (S)-6-acetamido-3-aminohexanoic acid zwitterion (CHEBI:137165) |
| Incoming Relation(s) |
| (S)-6-acetamido-3-aminohexanoic acid zwitterion (CHEBI:137165) is tautomer of (S)-6-acetamido-3-aminohexanoic acid (CHEBI:138105) |
| IUPAC Name |
|---|
| (3S)-6-acetamido-3-aminohexanoic acid |
| Synonyms | Source |
|---|---|
| N6-acetyl-L-β-lysine | MetaCyc |
| N'-Acetyl-beta-lysine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:131887-44-0 | ChemIDplus |
| Citations |
|---|