EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H2F17NO2S |
| Net Charge | 0 |
| Average Mass | 499.142 |
| Monoisotopic Mass | 498.95348 |
| SMILES | NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H2F17NO2S/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)29(26,27)28/h(H2,26,27,28) |
| InChIKey | RRRXPPIDPYTNJG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | persistent organic pollutant Any environmental contaminant that is resistant to environmental degradation through photolytic, biological or chemical processes. Such substances can have significant impact on health and the environment, as they persist in the environment, bioaccumulate in animal tissue and so biomagnify in food chains. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorooctanesulfonamide (CHEBI:138089) has role persistent organic pollutant (CHEBI:77853) |
| perfluorooctanesulfonamide (CHEBI:138089) is a perfluorinated compound (CHEBI:134091) |
| perfluorooctanesulfonamide (CHEBI:138089) is a sulfonamide (CHEBI:35358) |
| Incoming Relation(s) |
| perfluorooctane sulfonamidoacetic acid (CHEBI:83505) has functional parent perfluorooctanesulfonamide (CHEBI:138089) |
| IUPAC Name |
|---|
| 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonamide |
| Synonyms | Source |
|---|---|
| heptadecafluorooctanesulphonamide | ChemIDplus |
| perfluorooctanesulfonic acid amide | ChemIDplus |
| perfluoroctylsulfonamide | ChemIDplus |
| PFOSA | ChEBI |
| perfluorooctane sulfonamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Perfluorooctanesulfonamide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1813858 | Reaxys |
| CAS:754-91-6 | ChemIDplus |
| Citations |
|---|