EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O5 |
| Net Charge | 0 |
| Average Mass | 184.147 |
| Monoisotopic Mass | 184.03717 |
| SMILES | O=C(O)Cc1cc(O)c(O)cc1O |
| InChI | InChI=1S/C8H8O5/c9-5-3-7(11)6(10)1-4(5)2-8(12)13/h1,3,9-11H,2H2,(H,12,13) |
| InChIKey | FKWSAXDBQYTQDO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (4799943) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,5-trihydroxyphenylacetic acid (CHEBI:138055) has role human urinary metabolite (CHEBI:84087) |
| 2,4,5-trihydroxyphenylacetic acid (CHEBI:138055) has role human xenobiotic metabolite (CHEBI:76967) |
| 2,4,5-trihydroxyphenylacetic acid (CHEBI:138055) is a benzenetriol (CHEBI:22707) |
| 2,4,5-trihydroxyphenylacetic acid (CHEBI:138055) is a phenylacetic acids (CHEBI:25978) |
| 2,4,5-trihydroxyphenylacetic acid (CHEBI:138055) is conjugate acid of 2,4,5-trihydroxyphenylacetate (CHEBI:138056) |
| Incoming Relation(s) |
| 2,4,5-trihydroxyphenylacetate (CHEBI:138056) is conjugate base of 2,4,5-trihydroxyphenylacetic acid (CHEBI:138055) |
| IUPAC Name |
|---|
| (2,4,5-trihydroxyphenyl)acetic acid |
| Synonym | Source |
|---|---|
| 2-(2,4,5-trihydroxyphenyl)acetic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0130408 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2107725 | Reaxys |
| Citations |
|---|