EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | [H][C@]12CCC(C)=CC[C@]1(C)CC[C@@]2([H])/C(C)=C\CC=C(C)C |
| InChI | InChI=1S/C20H32/c1-15(2)7-6-8-17(4)18-12-14-20(5)13-11-16(3)9-10-19(18)20/h7-8,11,18-19H,6,9-10,12-14H2,1-5H3/b17-8-/t18-,19+,20+/m0/s1 |
| InChIKey | FUOLWDALQQTTKB-OHAZERQJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudolarix amabilis (ncbitaxon:3355) | root (BTO:0001188) | PubMed (28096378) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pseudolaratriene (CHEBI:138050) has role plant metabolite (CHEBI:76924) |
| pseudolaratriene (CHEBI:138050) is a carbobicyclic compound (CHEBI:36785) |
| pseudolaratriene (CHEBI:138050) is a diterpene (CHEBI:35190) |
| pseudolaratriene (CHEBI:138050) is a polycyclic olefin (CHEBI:35714) |
| IUPAC Name |
|---|
| rel-(3R,3aR,8aS)-6,8a-dimethyl-3-[(2Z)-6-methylhepta-2,5-dien-2-yl]-1,2,3,3a,4,5,8,8a-octahydroazulene |
| UniProt Name | Source |
|---|---|
| pseudolaratriene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-20245 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:30775058 | Reaxys |
| Citations |
|---|